| Drug ID: | Drug116 |
|---|
| Drug Name: | Sotrastaurin |
|---|
| CID: | 10296883 |
|---|
| DrugBank ID: | DB12369 |
|---|
| Modality: | Small Molecule |
|---|
| Groups: | NULL |
|---|
| US Approved: | NULL |
|---|
| Other Approved: | NULL |
|---|
| Identifier: |
NCT00572585
|
|---|
| Molecular Formula: | C25H22N6O2 |
|---|
| Molecular Weight: | 438.5 g/mol |
|---|
| Isomeric SMILES: | CN1CCN(CC1)C2=NC3=CC=CC=C3C(=N2)C4=C(C(=O)NC4=O)C5=CNC6=CC=CC=C65 |
|---|
| Synonyms: | Sotrastaurin; 425637-18-9; AEB071; Sotrastaurin (AEB071); AEB-071; 3-(1H-Indol-3-yl)-4-(2-(4-methylpiperazin-1-yl)quinazolin-4-yl)-1H-pyrrole-2,5-dione; sotrastaurina; sotrastaurine; 3-(1H-indol-3-yl)-4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]pyrrole-2,5-dione; NVP-AEB071 |
|---|
| Phase 0: | 0 |
|---|
| Phase 1: | 0 |
|---|
| Phase 2: | 0 |
|---|
| Phase 3: | 0 |
|---|
| Phase 4: | 0 |
|---|
| Description: | NULL |
|---|
-
-
| dtID | CID | Compound Name | Gene ID | Gene Name | Species | PubMed IDs | Action |
| dt969 |
10296883 |
Sotrastaurin |
1482 |
NKX2-5
|
Homo sapiens (human) |
|
Inhibitor |
| dt970 |
10296883 |
Sotrastaurin |
5582 |
PRKCG
|
Homo sapiens (human) |
|
None |
| dt971 |
10296883 |
Sotrastaurin |
2064 |
ERBB2
|
Homo sapiens (human) |
|
None |
| dt972 |
10296883 |
Sotrastaurin |
1017 |
CDK2
|
Homo sapiens (human) |
|
None |
| dt973 |
10296883 |
Sotrastaurin |
10110 |
SGK2
|
Homo sapiens (human) |
|
None |
| dt974 |
10296883 |
Sotrastaurin |
120892 |
LRRK2
|
Homo sapiens (human) |
|
None |
| dt975 |
10296883 |
Sotrastaurin |
5580 |
PRKCD
|
Homo sapiens (human) |
|
Inhibitor |
| dt976 |
10296883 |
Sotrastaurin |
5582 |
PRKCG
|
Homo sapiens (human) |
|
Inhibitor |
| dt977 |
10296883 |
Sotrastaurin |
2869 |
GRK5
|
Homo sapiens (human) |
|
None |
| dt978 |
10296883 |
Sotrastaurin |
6788 |
STK3
|
Homo sapiens (human) |
|
None |
- Phase 0: Exploratory trials to assess drug behavior in humans
- Phase 1: Safety trials to determine safe dosage range
- Phase 2: Efficacy trials to evaluate therapeutic effects
- Phase 3: Large-scale trials to confirm efficacy and safety
- Phase 4: Post-marketing surveillance for long-term safety and efficacy
| Trial ID | Title | Phase | Status | Sponsor | Indications | Interventions | |
| NCT00572585 |
Efficacy, Safety and Tolerability of AEB071 in Patients With Active, Moderate to Severe Ulcerative Colitis |
PHASE2 |
COMPLETED |
Novartis Pharmaceuticals |
Ulcerative Colitis |
DRUG: AEB071|DRUG: Placebo |
Details |
| Disease ID | Disease Name | Definition | Category | Related Drugs | Mechanism | |
| No data available |
| Strategy ID | Therapeutic Strategy | Synonyms | Related Drugs | Mechanism | |
| No data available |
PMID: 34376915
Year: 2021
Relationship Type:
Association
Score: 6.5
Inflammatory bowel diseases, including Crohn's disease and ulcerative colitis, are chronic inflammatory disorders associated with oxidative stress. T…
