| Drug ID: | Drug117 |
|---|
| Drug Name: | Vercirnon |
|---|
| CID: | 10343454 |
|---|
| DrugBank ID: | DB15250 |
|---|
| Modality: | Small Molecule |
|---|
| Groups: | NULL |
|---|
| US Approved: | NULL |
|---|
| Other Approved: | NULL |
|---|
| Identifier: |
NCT01658605
|
|---|
| Molecular Formula: | C22H21ClN2O4S |
|---|
| Molecular Weight: | 444.9 g/mol |
|---|
| Isomeric SMILES: | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2)Cl)C(=O)C3=CC=[N+](C=C3)[O-] |
|---|
| Synonyms: | Vercirnon; 698394-73-9; Traficet-EN; GSK-1605786; CCX282-B; Verecimon; GSK1605786; CCX-282-B; VERCIRNON [INN]; VERCIRNON [USAN] |
|---|
| Phase 0: | 0 |
|---|
| Phase 1: | 0 |
|---|
| Phase 2: | 0 |
|---|
| Phase 3: | 0 |
|---|
| Phase 4: | 0 |
|---|
| Description: | NULL |
|---|
-
-
| dtID | CID | Compound Name | Gene ID | Gene Name | Species | PubMed IDs | Action |
| dt979 |
10343454 |
Vercirnon |
10803 |
CCR9
|
Homo sapiens (human) |
20660125 |
Antagonist |
| dt980 |
10343454 |
Vercirnon |
10803 |
CCR9
|
Homo sapiens (human) |
20582872 |
C-C chemokine receptor type 9 antagonist |
| dt981 |
10343454 |
Vercirnon |
10803 |
CCR9
|
Homo sapiens (human) |
|
None |
| dt982 |
10343454 |
Vercirnon |
10803 |
CCR9
|
Homo sapiens (human) |
|
Inhibitor |
| dt983 |
10343454 |
Vercirnon |
10803 |
CCR9
|
Homo sapiens (human) |
|
Modulator |
| dt984 |
10343454 |
Vercirnon |
66 |
ACTBP6
|
Homo sapiens (human) |
|
Modulator |
| dt985 |
10343454 |
Vercirnon |
10803 |
CCR9
|
Homo sapiens (human) |
37713619 |
Modulator |
- Phase 0: Exploratory trials to assess drug behavior in humans
- Phase 1: Safety trials to determine safe dosage range
- Phase 2: Efficacy trials to evaluate therapeutic effects
- Phase 3: Large-scale trials to confirm efficacy and safety
- Phase 4: Post-marketing surveillance for long-term safety and efficacy
| Trial ID | Title | Phase | Status | Sponsor | Indications | Interventions | |
| NCT01658605 |
A Study to Investigate the Efficacy and Safety of GSK1605786 for Treatment of Patients With Active Ulcerative Colitis |
PHASE2 |
WITHDRAWN |
GlaxoSmithKline |
Colitis, Ulcerative |
DRUG: GSK1605786|OTHER: Placebo |
Details |
| Disease ID | Disease Name | Definition | Category | Related Drugs | Mechanism | |
| No data available |
| Strategy ID | Therapeutic Strategy | Synonyms | Related Drugs | Mechanism | |
| No data available |
PMID: 26400458
Year: 2015
Relationship Type:
Treatment
Score: 6.3
BACKGROUND: Many patients with active Crohn's disease do not adequately respond to therapies, highlighting the need for new treatments. AIMS: To cond…
