| Drug ID: | Drug140 |
|---|
| Drug Name: | Itacitinib |
|---|
| CID: | 53380437 |
|---|
| DrugBank ID: | DB12154 |
|---|
| Modality: | Small Molecule |
|---|
| Groups: | NULL |
|---|
| US Approved: | NULL |
|---|
| Other Approved: | NULL |
|---|
| Identifier: |
NCT03627052
|
|---|
| Molecular Formula: | C26H23F4N9O |
|---|
| Molecular Weight: | 553.5 g/mol |
|---|
| Isomeric SMILES: | C1CN(CCC1N2CC(C2)(CC#N)N3C=C(C=N3)C4=C5C=CNC5=NC=N4)C(=O)C6=C(C(=NC=C6)C(F)(F)F)F |
|---|
| Synonyms: | Itacitinib; 1334298-90-6; INCB039110; INCB-039110; Itacitinib [USAN]; 2-[1-[1-[3-fluoro-2-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]azetidin-3-yl]acetonitrile; 19J3781LPM; INCB-39110; ITACITINIB [INN]; Itacitinib [USAN:INN] |
|---|
| Phase 0: | 0 |
|---|
| Phase 1: | 0 |
|---|
| Phase 2: | 0 |
|---|
| Phase 3: | 0 |
|---|
| Phase 4: | 0 |
|---|
| Description: | NULL |
|---|
-
-
| dtID | CID | Compound Name | Gene ID | Gene Name | Species | PubMed IDs | Action |
| dt1113 |
53380437 |
Itacitinib |
3716 |
JAK1
|
Homo sapiens (human) |
|
Inhibitor |
| dt1114 |
53380437 |
Itacitinib |
3716 |
JAK1
|
Homo sapiens (human) |
|
Inhibition |
| dt1115 |
53380437 |
Itacitinib |
3717 |
JAK2
|
Homo sapiens (human) |
|
Inhibition |
| dt1116 |
53380437 |
Itacitinib |
3717 |
JAK2
|
Homo sapiens (human) |
37713619 |
Inhibitor |
| dt1117 |
53380437 |
Itacitinib |
3716 |
JAK1
|
Homo sapiens (human) |
37713619 |
Inhibitor |
| dt1118 |
53380437 |
Itacitinib |
3716 |
JAK1
|
Homo sapiens (human) |
|
Tyrosine-protein kinase JAK1 inhibitor |
| dt1119 |
53380437 |
Itacitinib |
3717 |
JAK2
|
Homo sapiens (human) |
|
Inhibitor |
| dt1120 |
53380437 |
Itacitinib |
7301 |
TYRO3
|
Homo sapiens (human) |
|
None |
- Phase 0: Exploratory trials to assess drug behavior in humans
- Phase 1: Safety trials to determine safe dosage range
- Phase 2: Efficacy trials to evaluate therapeutic effects
- Phase 3: Large-scale trials to confirm efficacy and safety
- Phase 4: Post-marketing surveillance for long-term safety and efficacy
| Trial ID | Title | Phase | Status | Sponsor | Indications | Interventions | |
| NCT03627052 |
A Study to Evaluate the Safety and Efficacy of Itacitinib in Moderate to Severe Ulcerative Colitis |
PHASE2 |
WITHDRAWN |
Incyte Corporation |
Moderate to Severe Ulcerative Colitis |
DRUG: Itacitinib|DRUG: Placebo |
Details |
| Disease ID | Disease Name | Definition | Category | Related Drugs | Mechanism | |
| No data available |
| Strategy ID | Therapeutic Strategy | Synonyms | Related Drugs | Mechanism | |
| No data available |
PMID: 32861662
Year: 2020
Relationship Type:
Treatment
Score: 9.5
Pharmacological modulation of the Janus kinase (JAK) family has achieved clinically meaningful therapeutic outcomes for the treatment of inflammatory…
