| Drug ID: | Drug162 |
|---|
| Drug Name: | Brepocitinib |
|---|
| CID: | 118878093 |
|---|
| DrugBank ID: | DB15003 |
|---|
| Modality: | Small Molecule |
|---|
| Groups: | NULL |
|---|
| US Approved: | NULL |
|---|
| Other Approved: | NULL |
|---|
| Identifier: |
NCT02958865
|
|---|
| Molecular Formula: | C18H21F2N7O |
|---|
| Molecular Weight: | 389.4 g/mol |
|---|
| Isomeric SMILES: | CN1C=C(C=N1)NC2=NC=CC(=N2)N3C[C@H]4CC[C@@H](C3)N4C(=O)[C@@H]5CC5(F)F |
|---|
| Synonyms: | Brepocitinib; PF-06700841; 1883299-62-4; Brepocitinib [USAN]; Brepocitinib (USAN); BREPOCITINIB [INN]; BREPOCITINIB [WHO-DD]; UNII-3X8387Q25N; [(1S)-2,2-difluorocyclopropyl]-[(1S,5R)-3-[2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]-3,8-diazabicyclo[3.2.1]octan-8-yl]methanone; compound 23 [PMID: 30113844] |
|---|
| Phase 0: | 0 |
|---|
| Phase 1: | 0 |
|---|
| Phase 2: | 0 |
|---|
| Phase 3: | 0 |
|---|
| Phase 4: | 0 |
|---|
| Description: | NULL |
|---|
-
-
| dtID | CID | Compound Name | Gene ID | Gene Name | Species | PubMed IDs | Action |
| dt1224 |
118878093 |
Brepocitinib |
2049 |
EPHB3
|
Homo sapiens (human) |
|
Inhibitor |
| dt1225 |
118878093 |
Brepocitinib |
7297 |
TYK2
|
Homo sapiens (human) |
|
Inhibitor |
| dt1226 |
118878093 |
Brepocitinib |
7297 |
TYK2
|
Homo sapiens (human) |
|
None |
| dt1227 |
118878093 |
Brepocitinib |
2048 |
EPHB2
|
Homo sapiens (human) |
|
Inhibitor |
| dt1228 |
118878093 |
Brepocitinib |
3718 |
JAK3
|
Homo sapiens (human) |
30113844 |
Inhibition |
| dt1229 |
118878093 |
Brepocitinib |
3716 |
JAK1
|
Homo sapiens (human) |
30113844 |
Inhibition |
| dt1230 |
118878093 |
Brepocitinib |
3717 |
JAK2
|
Homo sapiens (human) |
30113844 |
Inhibition |
| dt1231 |
118878093 |
Brepocitinib |
7297 |
TYK2
|
Homo sapiens (human) |
|
Tyrosine-protein kinase TYK2 inhibitor |
| dt1232 |
118878093 |
Brepocitinib |
3716 |
JAK1
|
Homo sapiens (human) |
|
Tyrosine-protein kinase JAK1 inhibitor |
- Phase 0: Exploratory trials to assess drug behavior in humans
- Phase 1: Safety trials to determine safe dosage range
- Phase 2: Efficacy trials to evaluate therapeutic effects
- Phase 3: Large-scale trials to confirm efficacy and safety
- Phase 4: Post-marketing surveillance for long-term safety and efficacy
| Trial ID | Title | Phase | Status | Sponsor | Indications | Interventions | |
| NCT02958865 |
Study to Compare Oral PF-06651600, PF-06700841 and Placebo in Subjects With Moderate to Severe Ulcerative Colitis |
PHASE2 |
COMPLETED |
Pfizer |
Ulcerative Colitis |
DRUG: PF-06651600 or Placebo|DRUG: PF-06700841 or… |
Details |
| Disease ID | Disease Name | Definition | Category | Related Drugs | Mechanism | |
| No data available |
| Strategy ID | Therapeutic Strategy | Synonyms | Related Drugs | Mechanism | |
| S07 |
Blockade of cytokine |
Cytokine signalling |
apremilast; roflumilast; filgotinib; tofacitinib; ABT494; ABT-874; ustekinumab; isankizumab; LY-2525623; AMG139; MEDI2079; guselkumab |
Various T-cell subsets, their differentiation pathways and … |
Details |
PMID: 36623678
Year: 2023
Relationship Type:
Treatment
Score: 7.5
BACKGROUND & AIMS: The efficacy and safety of ritlecitinib (oral JAK3/TEC family kinase inhibitor) and brepocitinib (oral TYK2/JAK1 inhibitor) as ind…
