| Drug ID: | Drug63 |
|---|---|
| Drug Name: | Meclinertant |
| CID: | 119192 |
| DrugBank ID: | DB06455 |
| Modality: | Small Molecule |
| Groups: | NULL |
| US Approved: | NULL |
| Other Approved: | NULL |
| Identifier: | NULL |
| Molecular Formula: | C32H31ClN4O5 |
| Molecular Weight: | 587.1 g/mol |
| Isomeric SMILES: | COC1=C(C(=CC=C1)OC)C2=CC(=NN2C3=C4C=CC(=CC4=NC=C3)Cl)C(=O)NC5(C6CC7CC(C6)CC5C7)C(=O)O |
| Synonyms: | Meclinertant; SR 48692; Reminertant; Meclinertant [INN]; 2-[[1-(7-chloroquinolin-4-yl)-5-(2,6-dimethoxyphenyl)pyrazole-3-carbonyl]amino]adamantane-2-carboxylic acid; UNII-5JBP4SI96H; 5JBP4SI96H; DTXSID40163360; 2-(((1-(7-CHLORO-4-QUINOLINYL)-5-(2,6-DIMETHOXYPHENYL)-1H-PYRAZOL-3-YL)CARBONYL)AMINO)-TRICYCLO(3.3.1.1(SUP 3,7))DECANE-2-CARBOXYLIC ACID; meclinertantum |
| Phase 0: | 0 |
| Phase 1: | 0 |
| Phase 2: | 0 |
| Phase 3: | 0 |
| Phase 4: | 0 |
| Description: | NULL |
Molecular Structure
Knowledge Graph
| dtID | CID | Compound Name | Gene ID | Gene Name | Species | PubMed IDs | Action |
|---|---|---|---|---|---|---|---|
| dt560 | 119192 | Meclinertant | 18217 | Ntsr2 | Mus musculus (house mouse) | 9480852 | Full agonist |
| dt561 | 119192 | Meclinertant | 23620 | NTSR2 | Homo sapiens (human) | 11723247 | Full agonist |
| dt562 | 119192 | Meclinertant | 366274 | Ntsr1 | Rattus norvegicus (Norway rat) | Antagonist | |
| dt563 | 119192 | Meclinertant | 4923 | NTSR1 | Homo sapiens (human) | 9023294 | Antagonist |
| dt564 | 119192 | Meclinertant | 4923 | NTSR1 | Homo sapiens (human) | 11723247 | Antagonist |
| dt565 | 119192 | Meclinertant | 4923 | NTSR1 | Homo sapiens (human) | Inhibitor | |
| dt566 | 119192 | Meclinertant | 4923 | NTSR1 | Homo sapiens (human) | None | |
| dt567 | 119192 | Meclinertant | 4923 | NTSR1 | Homo sapiens (human) | Neurotensin receptor 1 antagonist | |
| dt568 | 119192 | Meclinertant | 310 | ANXA7 | Homo sapiens (human) | Agonist | |
| dt569 | 119192 | Meclinertant | 847 | CAT | Mus musculus (house mouse) | 37952698 | SR 48692 results in decreased activity of CAT protein|sr 48692 affects the reaction [dietary fats results in decreased activity of CAT protein] |
Phase Distribution
Phase Description
- Phase 0: Exploratory trials to assess drug behavior in humans
- Phase 1: Safety trials to determine safe dosage range
- Phase 2: Efficacy trials to evaluate therapeutic effects
- Phase 3: Large-scale trials to confirm efficacy and safety
- Phase 4: Post-marketing surveillance for long-term safety and efficacy
| Trial ID | Title | Phase | Status | Sponsor | Indications | Interventions | |
|---|---|---|---|---|---|---|---|
| No data available | |||||||
| Disease ID | Disease Name | Definition | Category | Related Drugs | Mechanism | |
|---|---|---|---|---|---|---|
| No data available | ||||||
| Strategy ID | Therapeutic Strategy | Synonyms | Related Drugs | Mechanism | |
|---|---|---|---|---|---|
| S07 | Blockade of cytokine | Cytokine signalling | apremilast; roflumilast; filgotinib; tofacitinib; ABT494; ABT-874; ustekinumab; isankizumab; LY-2525623; AMG139; MEDI2079; guselkumab | Various T-cell subsets, their differentiation pathways and … | Details |
No related literature
You can run management commands to establish drug-literature associations