Repositioning Candidate Details
| Candidate ID: | R1020 |
| Source ID: | DB06455 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Meclinertant |
| Synonyms: | Meclinertant; Reminertant |
| Molecular Formula: | C32H31ClN4O5 |
| SMILES: | COC1=CC=CC(OC)=C1C1=CC(=NN1C1=C2C=CC(Cl)=CC2=NC=C1)C(=O)NC1(C2CC3CC(C2)CC1C3)C(O)=O |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 146362-70-1 |
| Molecular Weight: | 587.07 |
| DrugBank Indication: | Investigated for use/treatment in colorectal cancer, prostate cancer, schizophrenia and schizoaffective disorders, psychosis, depression, and lung cancer. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
