Repositioning Candidate Details
| Candidate ID: | R1031 |
| Source ID: | DB06497 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Aplaviroc |
| Synonyms: | Aplaviroc |
| Molecular Formula: | C33H43N3O6 |
| SMILES: | [H][C@@]1(NC(=O)C2(CCN(CC3=CC=C(OC4=CC=C(C=C4)C(O)=O)C=C3)CC2)N(CCCC)C1=O)[C@H](O)C1CCCCC1 |
| Structure: |
|
| DrugBank Description: | A spiro-diketo-piperazine; a potent noncompetitive allosteric antagonist of the CCR5 receptor with concomitantly potent antiviral effects for HIV-1. |
| CAS Number: | 461443-59-4 |
| Molecular Weight: | 577.722 |
| DrugBank Indication: | Investigated for use/treatment in HIV infection. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | GW873140 is a novel CCR5 receptor antagonist that binds specifically to human CCR5. It binds to human CCR5 with a unique profile as evidenced by the selective inhibition of monoclonal antibody binding. One of the many ways in which CCR5 inhibitors differ from the currently available classes of HIV drugs is that they bind to the host (CCR5 receptor), the cell, target rather than to the viral enzymes in cells like the CD4 cell. |
| Targets: | C-C chemokine receptor type 5 |
| Inclusion Criteria: | Target associated |
