Repositioning Candidate Details
| Candidate ID: | R1045 |
| Source ID: | DB06548 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Minodronic acid |
| Synonyms: | Minodronate; Minodronic acid |
| Molecular Formula: | C9H12N2O7P2 |
| SMILES: | OC(CC1=CN=C2C=CC=CN12)(P(O)(O)=O)P(O)(O)=O |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 180064-38-4 |
| Molecular Weight: | 322.1483 |
| DrugBank Indication: | Investigated for use/treatment in multiple myeloma, breast cancer, osteoporosis, and lung cancer. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | Farnesyl pyrophosphate synthase inhibitor; Geranylgeranyl pyrophosphate synthase inhibitor |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I15 | 1290 | Bone disease | A connective tissue disease that affects the structure or development of bone or causes an impairment of normal bone function. http://en.wikipedia.org/wiki/Bone_disease | disease of anatomical entity/ musculoskeletal system disease/connective tissue disease | Details |