Repositioning Candidate Details
| Candidate ID: | R1073 |
| Source ID: | DB06660 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Saredutant |
| Synonyms: | Saredutant |
| Molecular Formula: | C31H35Cl2N3O2 |
| SMILES: | CN(C[C@@H](CCN1CCC(CC1)(NC(C)=O)C1=CC=CC=C1)C1=CC=C(Cl)C(Cl)=C1)C(=O)C1=CC=CC=C1 |
| Structure: |
|
| DrugBank Description: | Saredutant (SR 48968) is a neurokinin-2 antagonist drug being developed as an antidepressant and anxiolytic by Sanofi-Aventis. |
| CAS Number: | 142001-63-6 |
| Molecular Weight: | 552.54 |
| DrugBank Indication: | Investigated for use/treatment in depression and anxiety disorders. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Saredutant works by blocking the effects of Neurokinin A at the NK-2 receptor. |
| Targets: | Substance-K receptor |
| Inclusion Criteria: | Indication associated |
