Repositioning Candidate Details
| Candidate ID: | R1088 |
| Source ID: | DB06729 |
| Source Type: | approved |
| Compound Type: | small molecule |
| Compound Name: | Sulfaphenazole |
| Synonyms: | 1-phenyl-5-sulfanilamidopyrazole; 3-(p-aminobenzenesulfonamido)-2-phenylpyrazole; 5-sulfanilamido-1-phenylpyrazole; N'-(1-phenylpyrazol-5-yl)sulfanilamide; N(1)-(1-phenylpyrazol-5-yl)sulfanilamide; Sulfaphenazole; Sulphaphenazole |
| Molecular Formula: | C15H14N4O2S |
| SMILES: | NC1=CC=C(C=C1)S(=O)(=O)NC1=CC=NN1C1=CC=CC=C1 |
| Structure: |
|
| DrugBank Description: | Sulfaphenazole is a sulfonamide antibacterial. |
| CAS Number: | 526-08-9 |
| Molecular Weight: | 314.362 |
| DrugBank Indication: | For the treatment bacterial infections. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Sulfaphenazole is a sulfonamide antibacterial. In bacteria, antibacterial sulfonamides act as competitive inhibitors of the enzyme dihydropteroate synthetase (DHPS), an enzyme involved in folate synthesis. As such, the microorganism will be "starved" of folate and die. |
| Targets: | Dihydropteroate synthase inhibitor |
| Inclusion Criteria: | Indication associated |

| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|