Repositioning Candidate Details
| Candidate ID: | R1129 |
| Source ID: | DB07744 |
| Source Type: | experimental |
| Compound Type: | small molecule |
| Compound Name: | Z-Val-Ala-Asp fluoromethyl ketone |
| Synonyms: | N-[(Benzyloxy)carbonyl]-L-valyl-N-[(2S)-1-carboxy-4-fluoro-3-oxo-2-butanyl]-L-alaninamide; Z-VAD-FMK |
| Molecular Formula: | C21H28FN3O7 |
| SMILES: | CC(C)[C@H](NC(=O)OCC1=CC=CC=C1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(O)=O)C(=O)CF |
| Structure: |
|
| DrugBank Description: | Non-methylated, competitive, and irreversible inhibitor of caspase 1, as well as other caspases,1 which can be used directly with purified enzymes. It does not require an esterase to hydrolyze the O-methyl ester like the cell-permeable form, Z-Val-Ala-Asp(O-Me) fluoromethyl ketone. |
| CAS Number: | 161401-82-7 |
| Molecular Weight: | 453.467 |
| DrugBank Indication: | -- |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | Caspase-1 |
| Inclusion Criteria: | Target associated |
