Repositioning Candidate Details
| Candidate ID: | R1264 |
| Source ID: | DB09246 |
| Source Type: | withdrawn |
| Compound Type: | small molecule |
| Compound Name: | Benmoxin |
| Synonyms: | Benmoxin; Mebamoxine |
| Molecular Formula: | C15H16N2O |
| SMILES: | CC(NNC(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Structure: |
|
| DrugBank Description: | Benmoxin is an irreversible and nonselective monoamine oxidase inhibitor (MAOI) of the hydrazine class. It was first synthesized in 1967 and rapidly used in Europe as an antidepressant. However, this agent is no longer marketed. |
| CAS Number: | 7654-03-7 |
| Molecular Weight: | 240.306 |
| DrugBank Indication: | For the treatment of depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
