Repositioning Candidate Details
| Candidate ID: | R1269 |
| Source ID: | DB09251 |
| Source Type: | withdrawn |
| Compound Type: | small molecule |
| Compound Name: | Phenoxypropazine |
| Synonyms: | -- |
| Molecular Formula: | C9H14N2O |
| SMILES: | [H]N([H])N([H])C(C)COC1=CC=CC=C1 |
| Structure: |
|
| DrugBank Description: | Phenoxypropazine is a non-selective and irreversible monoamine oxidase enzyme inhibitor (MAOI), belonging to the _hydrazine_ chemical class. It was marketed as an antidepressant in 1961 but was later withdrawn in 1966 because of its hepatotoxic potential. |
| CAS Number: | 3818-37-9 |
| Molecular Weight: | 166.224 |
| DrugBank Indication: | For the treatment of depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
