Repositioning Candidate Details
| Candidate ID: | R1271 |
| Source ID: | DB09253 |
| Source Type: | withdrawn |
| Compound Type: | small molecule |
| Compound Name: | Safrazine |
| Synonyms: | Safra |
| Molecular Formula: | C11H16N2O2 |
| SMILES: | CC(CCC1=CC2=C(OCO2)C=C1)NN |
| Structure: |
|
| DrugBank Description: | Safrazine is a member of the hydrazine family with non-selective and irreversible inhibitor effects against monoamine oxidases. In 1960, it was used as an antidepressant but it is now discontinued. |
| CAS Number: | 33419-68-0 |
| Molecular Weight: | 208.261 |
| DrugBank Indication: | For the treatment of depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
