Repositioning Candidate Details
| Candidate ID: | R1272 |
| Source ID: | DB09254 |
| Source Type: | withdrawn |
| Compound Type: | small molecule |
| Compound Name: | Caroxazone |
| Synonyms: | Caroxazone |
| Molecular Formula: | C10H10N2O3 |
| SMILES: | NC(=O)CN1CC2=CC=CC=C2OC1=O |
| Structure: |
|
| DrugBank Description: | Caroxazone is an antidepressant that has been withdrawn from the market. It is a reversible monoamine oxidase inhibitor (MAOI) of both A and B monoamine oxidase subtypes. However, it presents a five-fold preference for the MAO-B subtype. |
| CAS Number: | 18464-39-6 |
| Molecular Weight: | 206.201 |
| DrugBank Indication: | For the treatment of depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
