Repositioning Candidate Details
| Candidate ID: | R1294 |
| Source ID: | DB09305 |
| Source Type: | experimental |
| Compound Type: | small molecule |
| Compound Name: | Aptazapine |
| Synonyms: | Aptazapine |
| Molecular Formula: | C16H19N3 |
| SMILES: | CN1CCN2C(C1)C1=CC=CN1CC1=C2C=CC=C1 |
| Structure: |
|
| DrugBank Description: | Aptazapine (CGS-7525A) was a tetracyclic antidepressant developed in the 1980s. Aptazapine had noradrenergic and specific serotonergic activity. It antagonised α2 adrenergic receptors approximately 10 times more effectively than mianserin, antagonised 5-HT2 receptors, agonised H1 receptors, and did not affect reuptake of serotonin or norepinephrine. Although Aptazapine reached clinical trials, it was never marketed. |
| CAS Number: | 71576-40-4 |
| Molecular Weight: | 253.349 |
| DrugBank Indication: | Investigated for the treatment of depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
