Repositioning Candidate Details
| Candidate ID: | R1295 |
| Source ID: | DB09306 |
| Source Type: | experimental |
| Compound Type: | small molecule |
| Compound Name: | Metralindole |
| Synonyms: | Incasan; Inkazan; Metralindole |
| Molecular Formula: | C15H17N3O |
| SMILES: | COC1=CC2=C(C=C1)N1CCN(C)C3=NCCC2=C13 |
| Structure: |
|
| DrugBank Description: | Metralindole, also known as Inkazan, is similar in structure and pharmacology to pirlindole. It functions as a reversible inhibitor of monoamine oxidase A. In Russia, this drug was investigated for potential antidepressant activity. |
| CAS Number: | 54188-38-4 |
| Molecular Weight: | 255.321 |
| DrugBank Indication: | Investigated for the treatment of depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
