Repositioning Candidate Details
| Candidate ID: | R1296 |
| Source ID: | DB09307 |
| Source Type: | experimental |
| Compound Type: | small molecule |
| Compound Name: | Oxaprotiline |
| Synonyms: | Hydroxymaprotiline; Oxaprotiline |
| Molecular Formula: | C20H23NO |
| SMILES: | CNCC(O)CC12CCC(C3=CC=CC=C13)C1=CC=CC=C21 |
| Structure: |
|
| DrugBank Description: | Oxaprotiline is a norepinephrine reuptake inhibitor of the tetracyclic antidepressant family that is related to maprotiline. This drug was never marketed. Oxaprotiline is a racemic mixture of the isomers levoprotiline and dextroprotiline. Levoprotiline is the R or levo isomer of oxaprotiline (CGP-12,103-A). Dextroprotiline is the S or dextro isomer of oxaprotiline (CGP-12,104-A). Both enantiomers have antidepressant effects but levoprotiline also is an antihistamine and dextroprotiline has many other pharmacological actions. |
| CAS Number: | 56433-44-4 |
| Molecular Weight: | 293.41 |
| DrugBank Indication: | Investigated for the treatment of depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
