Repositioning Candidate Details
| Candidate ID: | R1469 |
| Source ID: | DB12960 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | INCB-9471 |
| Synonyms: | -- |
| Molecular Formula: | C30H40F3N5O2 |
| SMILES: | CCO[C@@H]1CC2=CC(=CC=C2[C@H]1N1CCN(C[C@@H]1C)C1(C)CCN(CC1)C(=O)C1=C(C)N=CN=C1C)C(F)(F)F |
| Structure: |
|
| DrugBank Description: | INCB-9471 is a novel, orally available CCR5 antagonist that is part of a new class of drugs to treat HIV/AIDS. It is a potent, selective inhibitor of the HIV-1 virus. |
| CAS Number: | 869769-98-2 |
| Molecular Weight: | 559.678 |
| DrugBank Indication: | -- |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | INCB-9471 is an antagonist of CCR5. It works through a different mechanism of action than currently marketed oral antiviral drugs. Rather than fighting HIV inside a patient's white blood cells, it prevents the virus from entering uninfected cells by blocking its predominant entry route, the CCR5 co-receptor. |
| Targets: | C-C chemokine receptor type 5 |
| Inclusion Criteria: | Target associated |
