Repositioning Candidate Details
| Candidate ID: | R1536 |
| Source ID: | DB14644 |
| Source Type: | approved |
| Compound Type: | small molecule |
| Compound Name: | Methylprednisolone hemisuccinate |
| Synonyms: | Methylprednisolone hemisuccinate; Methylprednisolone hydrogen succinate; Methylprednisolone succinate |
| Molecular Formula: | C26H34O8 |
| SMILES: | [H][C@@]12CC[C@](O)(C(=O)COC(=O)CCC(O)=O)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])C[C@H](C)C2=CC(=O)C=C[C@]12C |
| Structure: |
|
| DrugBank Description: | A water-soluble ester of methylprednisolone used for cardiac, allergic, and hypoxic emergencies. |
| CAS Number: | 2921-57-5 |
| Molecular Weight: | 474.55 |
| DrugBank Indication: | -- |
| DrugBank Pharmacology: | Methylprednisolone sodium succinate (the sodium salt of methylprednisolone hemisuccinate) has the same metabolic and anti-inflammatory actions as methylprednisolone. When given parenterally and in equimolar quantities, the two compounds are equivalent in biologic activity. |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Therapeutic strategy associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs | |
|---|---|---|---|---|---|
| S05 | Anti-inflammatory | inflammatory | Bile acid; TNF-a inhibitor; Dual PPAR-α and -δ agonists; Toll-Like Receptor; (TLR)-4 antagonist; Caspase inhibitor; ASK-1 inhibitor | Ursodeoxycholic Acid; Pentoxifylline; Elafibranor; JKB-121; Emricasan; Selonsertib; | Details |
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|