Repositioning Candidate Details
| Candidate ID: | R1552 |
| Source ID: | DB15021 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Leriglitazone |
| Synonyms: | Leriglitazone |
| Molecular Formula: | C19H20N2O4S |
| SMILES: | CC(O)C1=CN=C(CCOC2=CC=C(CC3SC(=O)NC3=O)C=C2)C=C1 |
| Structure: |
|
| DrugBank Description: | Leriglitazone is under investigation in clinical trial NCT03917225 (A Clinical Study to Evaluate the Effect of MIN-102 on the Progression of Friedreich's Ataxia in Male and Female Patients). |
| CAS Number: | 146062-44-4 |
| Molecular Weight: | 372.438 |
| DrugBank Indication: | -- |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | Peroxisome proliferator-activated receptor gamma |
| Inclusion Criteria: | Target associated |
