Repositioning Candidate Details
| Candidate ID: | R0753 |
| Source ID: | DB05255 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Ronacaleret |
| Synonyms: | Ronacaleret |
| Molecular Formula: | C25H31F2NO4 |
| SMILES: | CC(C)(CC1CC2=C(C1)C=CC=C2)NC[C@@H](O)COC1=CC(CCC(O)=O)=CC(F)=C1F |
| Structure: |
|
| DrugBank Description: | Ronacaleret is a calcium-sensing receptor antagonist. |
| CAS Number: | 753449-67-1 |
| Molecular Weight: | 447.523 |
| DrugBank Indication: | Post-menopausal women with osteoporosis |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | 751689 is novel small molecules that work by antagonizing calcium-sensing receptors on the surface of the parathyroid gland, thereby triggering a transient release of the body's own stores of parathyroid hormone (PTH). This release of PTH may have the potential to rebuild the bone mass lost as a result of osteoporosis and improve overall bone microarchitecture in these patients. |
| Targets: | Extracellular calcium-sensing receptor antagonist |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I15 | 1290 | Bone disease | A connective tissue disease that affects the structure or development of bone or causes an impairment of normal bone function. http://en.wikipedia.org/wiki/Bone_disease | disease of anatomical entity/ musculoskeletal system disease/connective tissue disease | Details |