Repositioning Candidate Details
| Candidate ID: | R0832 |
| Source ID: | DB05552 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | TG100-115 |
| Synonyms: | 3-(2,4-Diamino-6-(3-hydroxyphenyl)pteridin-7-yl)phenol; 6,7-Bis(3-hydroxyphenyl)pteridine-2,4-diamine |
| Molecular Formula: | C18H14N6O2 |
| SMILES: | NC1=NC(N)=C2N=C(C3=CC=CC(O)=C3)C(=NC2=N1)C1=CC(O)=CC=C1 |
| Structure: |
|
| DrugBank Description: | An NSAID that inhibits PI-3K gamma and delta. |
| CAS Number: | 677297-51-7 |
| Molecular Weight: | 346.35 |
| DrugBank Indication: | Investigated for use/treatment in angioedema and myocardial infarction. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform inhibitor; Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform inhibitor |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I08 | 114 | Cardiovascular system disease | A disease of anatomical entity which occurs in the blood, heart, blood vessels or the lymphatic system that passes nutrients (such as amino acids and electrolytes), gases, hormones, blood cells or lymph to and from cells in the body to help fight diseases and help stabilize body temperature and pH to maintain homeostasis. http://en.wikipedia.org/wiki/Circulatory_system | disease of anatomical entity | Details |