Repositioning Candidate Details
| Candidate ID: | R0851 |
| Source ID: | DB05695 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | NPS-2143 |
| Synonyms: | -- |
| Molecular Formula: | C24H25ClN2O2 |
| SMILES: | CC(C)(CC1=CC=C2C=CC=CC2=C1)NC[C@@H](O)COC1=CC=CC(Cl)=C1C#N |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 284035-33-2 |
| Molecular Weight: | 408.93 |
| DrugBank Indication: | Investigated for use/treatment in osteoporosis. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | NPS-2143 is the prototype calcilytic drug, designed to act on calcium receptors on the surface of parathyroid glands, stimulating the release of the body's own stores of native parathyroid hormone (PTH). |
| Targets: | Extracellular calcium-sensing receptor |
| Inclusion Criteria: | Indication associated |

| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I15 | 1290 | Bone disease | A connective tissue disease that affects the structure or development of bone or causes an impairment of normal bone function. http://en.wikipedia.org/wiki/Bone_disease | disease of anatomical entity/ musculoskeletal system disease/connective tissue disease | Details |