Repositioning Candidate Details
| Candidate ID: | R0855 |
| Source ID: | DB05735 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Cefilavancin |
| Synonyms: | Cefilavancin |
| Molecular Formula: | C87H95Cl3N16O28S2 |
| SMILES: | [H][C@]12SCC(C[N+]3=CC=CC=C3)=C(N1C(=O)[C@H]2NC(=O)C(=N/OCCCNC(=O)[C@H]1NC(=O)[C@H]2NC(=O)[C@H](NC(=O)[C@@H]3NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](NC(=O)[C@@H](CC(C)C)NC)[C@H](O)C4=CC=C(OC5=C(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@@]6([H])O[C@H]6C[C@](C)(N)[C@H](O)[C@H](C)O6)C(OC6=C(Cl)C=C(C=C6)[C@H]2O)=CC3=C5)C(Cl)=C4)C2=CC(=C(O)C=C2)C2=C1C=C(O)C=C2O)\C1=C(Cl)SC(N)=N1)C([O-])=O |
| Structure: |
|
| DrugBank Description: | Cefilavancin is a covalently-linked glycopeptide-cephalosporin (beta-lactam) heterodimer antibiotic that exhibits substantially greater activity than its component parts against Gram-positive bacteria. |
| CAS Number: | 722454-12-8 |
| Molecular Weight: | 1983.27 |
| DrugBank Indication: | Investigated for use/treatment in bacterial infection, skin infections/disorders, and staph bacterial infections. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|