Repositioning Candidate Details
| Candidate ID: | R0905 |
| Source ID: | DB05964 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Amitifadine |
| Synonyms: | -- |
| Molecular Formula: | C11H11Cl2N |
| SMILES: | [H][C@]12C[C@]1(CNC2)C1=CC(Cl)=C(Cl)C=C1 |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 410074-73-6 |
| Molecular Weight: | 228.12 |
| DrugBank Indication: | Investigated for use/treatment in depression. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | DOV 21947 exhibits antidepressant-like properties as well as potent analgesic activity. It inhibits reuptake of the three neurotransmitters most closely linked to depression - serotonin, norepinephrine and dopamine - can produce greater overall efficacy than currently marketed antidepressants. |
| Targets: | Sodium-dependent serotonin transporter; Sodium-dependent noradrenaline transporter; Dopamine D2 receptor |
| Inclusion Criteria: | Indication associated |
