Repositioning Candidate Details
| Candidate ID: | R0923 |
| Source ID: | DB06087 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Friulimicin B |
| Synonyms: | Friulimycin B |
| Molecular Formula: | C59H94N14O19 |
| SMILES: | CC(C)CCCCCCC\C=C/CC(=O)N[C@@H](CC(N)=O)C(=O)N[C@H]1[C@H](C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](NC(=O)[C@H](NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](NC(=O)[C@H]2CCCCN2C1=O)[C@H](C)C(O)=O)[C@@H](C)N)C(C)C |
| Structure: |
|
| DrugBank Description: | Friulimicin B is a naturally occurring antibiotic produced by a micro-organism, *Actinoplanes friuliensis*. It shows strong cidal activity against a number of Gram-positive pathogens which commonly cause serious infections in hospital patients and which are becoming more routinely acquired in the community. |
| CAS Number: | 239802-15-4 |
| Molecular Weight: | 1303.48 |
| DrugBank Indication: | Investigated for use/treatment in bacterial infection. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Friulimicin B, in the presence of calcium, forms a complex with a lipid carrier that acts in cell wall biosynthesis and which is not targeted by other antibiotics currently in use. Friulimicin B appears to block two essential pathways in the cell envelope and the complexes formed prevent the formation of a functional cell wall. |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|