Repositioning Candidate Details
| Candidate ID: | R0935 |
| Source ID: | DB06160 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Garenoxacin |
| Synonyms: | Garenoxacin |
| Molecular Formula: | C23H20F2N2O4 |
| SMILES: | C[C@H]1NCC2=CC(=CC=C12)C1=CC=C2C(=O)C(=CN(C3CC3)C2=C1OC(F)F)C(O)=O |
| Structure: |
|
| DrugBank Description: | Garenoxacin, a quinolone antibiotic, is being investigated for the treatment of gram-positive and gram-negative bacterial infections. |
| CAS Number: | 194804-75-6 |
| Molecular Weight: | 426.42 |
| DrugBank Indication: | Investigated for use/treatment in bacterial infection. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | -- |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|