Repositioning Candidate Details
| Candidate ID: | R0950 |
| Source ID: | DB06231 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Caldaret |
| Synonyms: | Caldaret |
| Molecular Formula: | C11H16N2O3S |
| SMILES: | CC1=CC=C(N2CCNCC2)C(=C1)S(O)(=O)=O |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 133804-44-1 |
| Molecular Weight: | 256.32 |
| DrugBank Indication: | Investigated for use/treatment in heart disease and myocardial infarction. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Cardiac damage due to the buildup of sodium (Na+) ischemia and early reperfusion leads to increased calcium (Ca2+) through the reverse mode Na+/Ca2+(NCX) ion exchanger. Caldaret is an intracardiac calcium (Ca2+) handling modulator whose cardioprotective actions are presumed to be due to inhibition of the NCX exhanger and increasing the uptake of Ca2+ via the sarcoplasmic reticulum (SR). |
| Targets: | Sodium/calcium exchanger 1 |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I08 | 114 | Cardiovascular system disease | A disease of anatomical entity which occurs in the blood, heart, blood vessels or the lymphatic system that passes nutrients (such as amino acids and electrolytes), gases, hormones, blood cells or lymph to and from cells in the body to help fight diseases and help stabilize body temperature and pH to maintain homeostasis. http://en.wikipedia.org/wiki/Circulatory_system | disease of anatomical entity | Details |