Repositioning Candidate Details
| Candidate ID: | R0990 |
| Source ID: | DB06350 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Elinogrel |
| Synonyms: | Elinogrel |
| Molecular Formula: | C20H15ClFN5O5S2 |
| SMILES: | CNC1=C(F)C=C2C(NC(=O)N(C2=O)C2=CC=C(NC(=O)NS(=O)(=O)C3=CC=C(Cl)S3)C=C2)=C1 |
| Structure: |
|
| DrugBank Description: | A P2Y12 inhibitor and platelet aggregation inhibitor. |
| CAS Number: | 936500-94-6 |
| Molecular Weight: | 523.94 |
| DrugBank Indication: | Investigated for use/treatment in cardiovascular disorders and myocardial infarction. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | PRT060128 is a specific, reversible ADP receptor antagonist that binds to the P2Y12 receptor on platelets. PRT06128 prevents binding of adenosine diphosphate (ADP) to its platelet receptor, impairing the ADP-mediated activation of the glycoprotein GPIIb/IIIa complex, a key step in the coagulation cascade. PRT060128 likely has a similar mechanism of action to clopidogrel. |
| Targets: | P2Y purinoceptor 12 |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I08 | 114 | Cardiovascular system disease | A disease of anatomical entity which occurs in the blood, heart, blood vessels or the lymphatic system that passes nutrients (such as amino acids and electrolytes), gases, hormones, blood cells or lymph to and from cells in the body to help fight diseases and help stabilize body temperature and pH to maintain homeostasis. http://en.wikipedia.org/wiki/Circulatory_system | disease of anatomical entity | Details |