Repositioning Candidate Details
| Candidate ID: | R0995 |
| Source ID: | DB06367 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Relacatib |
| Synonyms: | Relacatib |
| Molecular Formula: | C27H32N4O6S |
| SMILES: | CC(C)C[C@H](NC(=O)C1=CC2=CC=CC=C2O1)C(=O)N[C@H]1CC[C@@H](C)N(CC1=O)S(=O)(=O)C1=CC=CC=N1 |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 362505-84-8 |
| Molecular Weight: | 540.64 |
| DrugBank Indication: | Investigated for use/treatment in osteoporosis and bone metastases. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Relacatib is a small-molecule drug that inhibits the activity of cathepsin K, an enzyme that appears to be implicated in osteoporosis, osteoarthritis and certain other disorders causing bone degradation. |
| Targets: | Cathepsin K |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I15 | 1290 | Bone disease | A connective tissue disease that affects the structure or development of bone or causes an impairment of normal bone function. http://en.wikipedia.org/wiki/Bone_disease | disease of anatomical entity/ musculoskeletal system disease/connective tissue disease | Details |