Natural Product Details
Structure:
| Product ID: | N01038 |
| Product Name: | Octadeca-9,12- dienoic acid |
| CAS No: | 506218 |
| Molecular Formula: | C18H32O2 |
| SMILES: | CCCCC/C=C/C/C=C/CCCCCCCC(=O)O |
| InChiKey: | OYHQOLUKZRVURQ-AVQMFFATSA-N |
| Category: | Fatty acids |
| Biological Source: |
