Natural Product Details
Structure:
| Product ID: | N06387 |
| Product Name: | -- |
| CAS No: | 866621116 |
| Molecular Formula: | C22H22O10 |
| SMILES: | COc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChiKey: | YLOZPZMPWNUOJV-DRASZATQSA-N |
| Category: | Shikimates and Phenylpropanoids |
| Biological Source: |
