Natural Product Details
Structure:
| Product ID: | N06797 |
| Product Name: | -- |
| CAS No: | 62137557 |
| Molecular Formula: | C5H12O4 |
| SMILES: | C[C@H](O)[C@H](O)[C@H](O)CO |
| InChiKey: | FJGNTEKSQVNVTJ-LMVFSUKVSA-N |
| Category: | Fatty acids |
| Biological Source: |
