Natural Product Details
Structure:
| Product ID: | N07009 |
| Product Name: | 4- hydroxymethylphenyl β-D-glucoside |
| CAS No: | 62499278 |
| Molecular Formula: | C13H18O7 |
| SMILES: | OCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChiKey: | PUQSUZTXKPLAPR-UJPOAAIJSA-N |
| Category: | -- |
| Biological Source: |
