Natural Product Details
Structure:
| Product ID: | N07832 |
| Product Name: | -- |
| CAS No: | 3952985 |
| Molecular Formula: | C10H17NO9S2.K |
| SMILES: | C=CC(/C([O-])=N/OS(=O)(=O)O)[C@@]1(S)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O.[K+] |
| InChiKey: | ZBPITIMFPSNOHX-CMSCJIJWSA-M |
| Category: | -- |
| Biological Source: |
