Natural Product Details
Structure:
| Product ID: | N07879 |
| Product Name: | ( E) -9-octadecenoic acid,methyl ester |
| CAS No: | 1937628 |
| Molecular Formula: | C19H36O2 |
| SMILES: | CCCCCCCC/C=C/CCCCCCCC(=O)OC |
| InChiKey: | QYDYPVFESGNLHU-ZHACJKMWSA-N |
| Category: | Fatty acids |
| Biological Source: |
