Repositioning Candidate Details
| Candidate ID: | R1023 |
| Source ID: | DB06469 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Lestaurtinib |
| Synonyms: | Lestaurtinib |
| Molecular Formula: | C26H21N3O4 |
| SMILES: | C[C@]12O[C@H](C[C@]1(O)CO)N1C3=C(C=CC=C3)C3=C1C1=C(C4=C3C(=O)NC4)C3=CC=CC=C3N21 |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 111358-88-4 |
| Molecular Weight: | 439.471 |
| DrugBank Indication: | Investigated for use/treatment in pancreatic cancer, prostate cancer, and leukemia (myeloid). |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Lestaurtinib inhibits autophosphorylation of FMS-like tyrosine kinase 3 (FLT3), resulting in inhibition of FLT3 activity and induction of apoptosis in tumor cells that overexpress FLT3. |
| Targets: | Receptor-type tyrosine-protein kinase FLT3 |
| Inclusion Criteria: | Therapeutic strategy associated |
