Repositioning Candidate Details
| Candidate ID: | R1050 |
| Source ID: | DB06587 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Mitemcinal |
| Synonyms: | Mitemcinal |
| Molecular Formula: | C40H69NO12 |
| SMILES: | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C(C)C)[C@@]2(C)CC(C)=C(O2)[C@H](C)C(=O)[C@]1(C)OC |
| Structure: |
|
| DrugBank Description: | Mitemcinal (GM-611) is a novel erythromycin-derived prokinetic agent that acts as an agonist at the motilin receptor. |
| CAS Number: | 154738-42-8 |
| Molecular Weight: | 755.987 |
| DrugBank Indication: | Investigated for use/treatment in gastroparesis and irritable bowel syndrome (IBS). |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Mitemcinal, an oral motilin agonist, accelerates gastric emptying. |
| Targets: | Motilin receptor |
| Inclusion Criteria: | Indication associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|