Repositioning Candidate Details
| Candidate ID: | R1399 |
| Source ID: | DB11752 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Bryostatin 1 |
| Synonyms: | -- |
| Molecular Formula: | C47H68O17 |
| SMILES: | [H][C@]12C[C@H](OC(C)=O)C(C)(C)[C@](O)(C[C@]3([H])C\C(C[C@@]([H])(O3)\C=C\C(C)(C)[C@]3(O)O[C@@]([H])(C\C(=C/C(=O)OC)[C@@H]3OC(=O)\C=C\C=C\CCC)C[C@@]([H])(OC(=O)C[C@H](O)C1)[C@@H](C)O)=C\C(=O)OC)O2 |
| Structure: |
|
| DrugBank Description: | Bryostatin 1 has been investigated for the treatment of HIV Infection and Alzheimer's Disease. |
| CAS Number: | 83314-01-6 |
| Molecular Weight: | 905.044 |
| DrugBank Indication: | -- |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | Protein kinase C alpha type activator; Protein kinase C epsilon type activator; Caspase-8 inhibitor; Serine/threonine-protein kinase D1 activator; T-lymphocyte activation antigen CD86 inducer; Prostaglandin G/H synthase 2 inducer; G1/S-specific cyclin-D1 inhibitor; Tumor necrosis factor inducer; Protein unc-13 homolog B ligand |
| Inclusion Criteria: | Target associated |
