Repositioning Candidate Details
| Candidate ID: | R0522 |
| Source ID: | DB01427 |
| Source Type: | approved |
| Compound Type: | small molecule |
| Compound Name: | Amrinone |
| Synonyms: | Amrinone; Inamrinone |
| Molecular Formula: | C10H9N3O |
| SMILES: | NC1=CC(=CNC1=O)C1=CC=NC=C1 |
| Structure: |
|
| DrugBank Description: | Amrinone (or inamrinone) is a type 3 pyridine phosphodiesterase inhibitor. It is used in the treatment of congestive heart failure. |
| CAS Number: | 60719-84-8 |
| Molecular Weight: | 187.198 |
| DrugBank Indication: | Used in the treatment of congestive heart failure. |
| DrugBank Pharmacology: | Amrinone is a positive inotropic cardiotonic with vasodilator properties, phosphodiesterase inhibitory activity, and the ability to stimulate calcium ion influx into the cardiac cell. |
| DrugBank MoA: | Amrinone is a phosphodiesterase inhibitor (PDE3), resulting in increased cAMP and cGMP which leads to an increase in the calcium influx like that caused by beta-agonists resulting in increased inotropic effect. |
| Targets: | cGMP-inhibited 3',5'-cyclic phosphodiesterase A inhibitor; Tumor necrosis factor inhibitor; cGMP-inhibited 3',5'-cyclic phosphodiesterase B inhibitor; cAMP-specific 3',5'-cyclic phosphodiesterase 4 (PDE4) inhibitor; cAMP-specific 3',5'-cyclic phosphodiesterase 3 inhibitor |
| Inclusion Criteria: | Target associated |
