Repositioning Candidate Details
| Candidate ID: | R0580 |
| Source ID: | DB03310 |
| Source Type: | approved; experimental; investigational |
| Compound Type: | small molecule |
| Compound Name: | Glutathione disulfide |
| Synonyms: | Glutathione disulphide; GSSG; Oxidized glutathione; Oxiglutatione |
| Molecular Formula: | C20H32N6O12S2 |
| SMILES: | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O)C(=O)NCC(O)=O)C(O)=O |
| Structure: |
|
| DrugBank Description: | A GLUTATHIONE dimer formed by a disulfide bond between the cysteine sulfhydryl side chains during the course of being oxidized. |
| CAS Number: | 27025-41-8 |
| Molecular Weight: | 612.631 |
| DrugBank Indication: | -- |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | Glutathione S-transferase Mu 2 activator; Glutathione reductase, mitochondrial substrate; Glutathione peroxidase; Microsomal glutathione S-transferase 1 activator; Glutathione S-transferases (Cytosolic) activator |
| Inclusion Criteria: | Target associated |
