Repositioning Candidate Details
| Candidate ID: | R0585 |
| Source ID: | DB03496 |
| Source Type: | experimental; investigational |
| Compound Type: | small molecule |
| Compound Name: | Alvocidib |
| Synonyms: | Alvocidib freebase; Flavopiridol |
| Molecular Formula: | C21H20ClNO5 |
| SMILES: | CN1CC[C@@H]([C@H](O)C1)C1=C(O)C=C(O)C2=C1OC(=CC2=O)C1=CC=CC=C1Cl |
| Structure: |
|
| DrugBank Description: | Alvocidib is a synthetic flavonoid based on an extract from an Indian plant for the potential treatment of cancer. It works by inhibiting cyclin-dependent kinases, arresting cell division and causing apoptosis in non-small lung cancer cells. |
| CAS Number: | 146426-40-6 |
| Molecular Weight: | 401.84 |
| DrugBank Indication: | Investigated for use/treatment in esophageal cancer, leukemia (lymphoid), lung cancer, liver cancer, and lymphoma (unspecified). |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Inhibits cyclin-dependent kinases, arresting cell division and causing apoptosis in non-small lung cancer cells. |
| Targets: | Cyclin-dependent kinase 2 inhibitor; Cyclin-dependent kinase 5; Cyclin-dependent kinase 9; Cyclin-dependent kinase 1; Cyclin-dependent kinase 6; Epidermal growth factor receptor; Cyclin-dependent kinase 4; Cyclin-dependent kinase 8; Cyclin-dependent kinase 7; Glycogen phosphorylase, muscle form; Glycogen phosphorylase, brain form; Glycogen phosphorylase, liver form |
| Inclusion Criteria: | Therapeutic strategy associated |
