Repositioning Candidate Details
| Candidate ID: | R0612 |
| Source ID: | DB04690 |
| Source Type: | experimental |
| Compound Type: | small molecule |
| Compound Name: | Camptothecin |
| Synonyms: | (+)-camptothecin; (+)-camptothecine; (S)-(+)-camptothecin; 20(S)-camptothecine; 21,22-Secocamptothecin-21-oic acid lactone; Camptothecine; D-camptothecin |
| Molecular Formula: | C20H16N2O4 |
| SMILES: | CC[C@@]1(O)C(=O)OCC2=C1C=C1N(CC3=CC4=CC=CC=C4N=C13)C2=O |
| Structure: |
|
| DrugBank Description: | Camptothecin is an alkaloid isolated from the stem wood of the Chinese tree, <i>Camptotheca acuminata</i>. This compound selectively inhibits the nuclear enzyme DNA topoisomerase, type I. Several semisynthetic analogs of camptothecin have demonstrated antitumor activity. |
| CAS Number: | 7689-03-4 |
| Molecular Weight: | 348.352 |
| DrugBank Indication: | Investigated for the treatment of cancer. |
| DrugBank Pharmacology: | Camptothecin demonstrated strong anticancer activity in preliminary clinical trials but also low solubility and adverse drug reaction. Camptothecin is believed to be a potent topoisomerase inhibitor that interferes with the essential function of topoisomerase in DNA replication. |
| DrugBank MoA: | Camptothecin binds to the topoisomerase I and DNA complex resulting in a ternary complex, stabilizing it and preventing DNA re-ligation and therefore causes DNA damage which results in apoptosis. |
| Targets: | DNA topoisomerase 1 |
| Inclusion Criteria: | Therapeutic strategy associated |
