Repositioning Candidate Details
| Candidate ID: | R0666 |
| Source ID: | DB04977 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Plitidepsin |
| Synonyms: | Dehydrodidemnin B; Plitidepsin |
| Molecular Formula: | C57H87N7O15 |
| SMILES: | [H][C@@]12CCCN1C(=O)[C@H](CC(C)C)NC(=O)[C@@H](C)C(=O)[C@@H](OC(=O)C[C@H](O)[C@]([H])(NC(=O)[C@@H](NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@@H]1CCCN1C(=O)C(C)=O)[C@@H](C)OC(=O)[C@H](CC1=CC=C(OC)C=C1)N(C)C2=O)[C@@H](C)CC)C(C)C |
| Structure: |
|
| DrugBank Description: | Aplidine is a peptide found in tunicates which shows promise in shrinking tumors in pancreatic, stomach, bladder, and prostate cancers. The specific marine organism is _Aplidium albicans_. Aplidine is also of interest as a potential treatment for some leukemias. |
| CAS Number: | 137219-37-5 |
| Molecular Weight: | 1110.357 |
| DrugBank Indication: | Intended for the treatment of various forms of cancer. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | Aplidine inhibits the growth and induces apoptosis in MOLT-4 cells through the indirect inhibition of VEGF secretion which blocks the VEGF/VEGFR-1 autocrine loop necessary for the growth of these cells. |
| Targets: | -- |
| Inclusion Criteria: | Therapeutic strategy associated |
