Repositioning Candidate Details
| Candidate ID: | R0668 |
| Source ID: | DB04980 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Lemuteporfin |
| Synonyms: | Lemuteporfin |
| Molecular Formula: | C44H48N4O10 |
| SMILES: | COC(=O)C1C(=CC=C2\C3=C\C4=N\C(=C/C5=C(C)C(CCC(=O)OCCO)=C(N5)\C=C5/N=C(/C=C(\N3)C12C)C(C)=C5CCC(=O)OCCO)\C(C=C)=C4C)C(=O)OC |
| Structure: |
|
| DrugBank Description: | Lemuteporfin, under development by QLT Incorporated, is a benzoporphyrin-derived chlorin-like photosensitizer. It is intended for the treatment of beign prostatic hyperplasia. |
| CAS Number: | 215808-49-4 |
| Molecular Weight: | 792.886 |
| DrugBank Indication: | Intended for the treatment of benign prostatic hyperplasia and prostrate disorders. |
| DrugBank Pharmacology: | Trial data accumulated thus far indicate a generally positive tollerability profile and preliminary efficacy. |
| DrugBank MoA: | Lemuteporfin is transported in the plasma primarily by lipoproteins. Once lemuteporfin is activated by light in the presence of oxygen, highly reactive, short-lived singlet oxygen and reactive oxygen radicals are generated. Light activation of lemuteporfin results in local damage to neovascular endothelium, resulting in vessel occlusion. Damaged endothelium is known to release procoagulant and vasoactive factors through the lipo-oxygenase (leukotriene) and cyclo-oxygenase (eicosanoids such as thromboxane) pathways, resulting in platelet aggregation, fibrin clot formation and vasoconstriction. |
| Targets: | -- |
| Inclusion Criteria: | Therapeutic strategy associated |
