Repositioning Candidate Details
| Candidate ID: | R0825 |
| Source ID: | DB05513 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Atiprimod |
| Synonyms: | Atiprimod; Azaspirane; N,N-Diethyl-8,8-dipropyl-2-azaspiro(4.5)decane-2-propanamine |
| Molecular Formula: | C22H44N2 |
| SMILES: | CCCC1(CCC)CCC2(CCN(CCCN(CC)CC)C2)CC1 |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 123018-47-3 |
| Molecular Weight: | 336.608 |
| DrugBank Indication: | Investigated for use/treatment in cancer/tumors (unspecified), multiple myeloma, and rheumatoid arthritis. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | -- |
| Targets: | Interleukin-6; Tumor necrosis factor |
| Inclusion Criteria: | Target associated |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class | |
|---|---|---|---|---|---|
| I15 | 1290 | Bone disease | A connective tissue disease that affects the structure or development of bone or causes an impairment of normal bone function. http://en.wikipedia.org/wiki/Bone_disease | disease of anatomical entity/ musculoskeletal system disease/connective tissue disease | Details |