Repositioning Candidate Details
| Candidate ID: | R0843 |
| Source ID: | DB05660 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | D-JNKI-1 |
| Synonyms: | D-JNKI 1 peptide |
| Molecular Formula: | C164H285N65O41 |
| SMILES: | CC(C)C[C@@H](NC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)[C@H]1CCCN1C(=O)[C@@H](CCC(N)=O)NC(=O)[C@H](NC(=O)[C@H]1CCCN1C(=O)[C@@H](CCCNC(N)=N)NC(=O)[C@@H](CO)NC(=O)[C@@H](CCC(N)=O)NC(=O)[C@H](N)CC(O)=O)C(C)C)C(=O)N[C@H](CC(N)=O)C(=O)N[C@H](CC(C)C)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@H]([C@H](C)O)C(=O)N1CCC[C@@H]1C(=O)N[C@H](CCCNC(N)=N)C(=O)N[C@H](CCCCN)C(=O)N1CCC[C@@H]1C(=O)N[C@H](CCCNC(N)=N)C(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)N[C@H](CCCNC(N)=N)C(=O)N[C@H](CCCNC(N)=N)C(=O)N[C@H](CCCNC(N)=N)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H](CCCNC(N)=N)C(=O)N[C@H](CCCNC(N)=N)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCCN)C(=O)N[C@H](CCCNC(N)=N)C(=O)NCC(O)=O |
| Structure: |
|
| DrugBank Description: | A synthetic, cell permeable peptide that blocks the MAPK-JNK signal pathway; has potential therapeutic value for long-term protection of both the morphological integrity and physiological function of the organ of Corti during times of oxidative stress. |
| CAS Number: | 1198367-70-2 |
| Molecular Weight: | 3823.498 |
| DrugBank Indication: | Investigated for use/treatment in hearing loss. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | AM-111 is an inhibitor of c-Jun N-terminal kinase-mediated apoptosis and inflammation. |
| Targets: | -- |
| Inclusion Criteria: | Therapeutic strategy associated |
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|