Repositioning Candidate Details
| Candidate ID: | R0907 |
| Source ID: | DB05969 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | SNS-032 |
| Synonyms: | -- |
| Molecular Formula: | C17H24N4O2S2 |
| SMILES: | CC(C)(C)C1=CN=C(CSC2=CN=C(NC(=O)C3CCNCC3)S2)O1 |
| Structure: |
|
| DrugBank Description: | -- |
| CAS Number: | 345627-80-7 |
| Molecular Weight: | 380.53 |
| DrugBank Indication: | Investigated for use/treatment in cancer/tumors (unspecified), leukemia (unspecified), lymphoma (unspecified), multiple myeloma, and solid tumors. |
| DrugBank Pharmacology: | -- |
| DrugBank MoA: | SNS-032 is a potent and selective inhibitor of CDKs 2, 7 and 9, which are critical in the communication and relay of signals to promote cellular growth and function. CDK2 is involved in cellular proliferation by regulating the initiation of and progression through the DNA-synthesis phase of the cell cycle. CDK7 and CDK9 are involved in transcriptional regulation of certain proteins involved in cell survival. Inappropriate activity by these CDKs can lead to unregulated proliferation, avoidance of apoptosis and increased cell survival, all of which are hallmarks of cancer. By selectively targeting these CDKs, SNS-032 may halt both aberrant cell proliferation and induce apoptosis. |
| Targets: | Cyclin-dependent kinase 7; Vascular endothelial growth factor A |
| Inclusion Criteria: | Therapeutic strategy associated |
