Repositioning Candidate Details
| Candidate ID: | R0915 |
| Source ID: | DB06040 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Filanesib |
| Synonyms: | Filanesib |
| Molecular Formula: | C20H22F2N4O2S |
| SMILES: | CON(C)C(=O)N1N=C(S[C@@]1(CCCN)C1=CC=CC=C1)C1=CC(F)=CC=C1F |
| Structure: |
|
| DrugBank Description: | Filanesib is a potent Kinesin Spindle Protein (KSP) inhibitor that caused marked tumor regression in preclinical models of human solid tumors and human leukemias, often leading to durable responses. |
| CAS Number: | 885060-09-3 |
| Molecular Weight: | 420.48 |
| DrugBank Indication: | Investigated for use/treatment in cancer/tumors (unspecified). |
| DrugBank Pharmacology: | This compound is a highly potent KSP inhibitor that demonstrates subnanomolar potency in both enzymatic and cellular assays and causes mitotic arrest, leading to cell death or apoptosis of the immensely proliferating cancer cells. |
| DrugBank MoA: | KSP has been identified as an attractive drug target against cancer. Cancer results when normal cellular processes go awry and lead to a massive, uncontrolled cell division, proliferation, and growth. Inhibitors of KSP cause mitotic arrest by preventing the formation of bipolar spindle. The monopolar spindle thus prevents the separation of centrosomes, organizes the microtubules from a single locus in the cell, and aligns the chromosomes around this locus. This compound is a highly potent KSP inhibitor that demonstrates subnanomolar potency in both enzymatic and cellular assays and causes mitotic arrest, leading to cell death or apoptosis of the immensely proliferating cancer cells. |
| Targets: | Kinesin-like protein KIF11 |
| Inclusion Criteria: | Therapeutic strategy associated |
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|